Отваря главното меню

Промени

1671 байта изтрити ,  преди 6 години
м
Химкутия
{{Химкутия 2
| картинка = {{Инфокаре картинки
| име = {{PAGENAME}}
| ImageFile | {{Инфоелемент = картинка|Adenosintriphosphat protoniert.svg}}
| {{Химкартинка
| ImageFile1 | {{Инфоелемент = картинка|AdenosineTriphosphate.qutemol.gif}}
| ImageFile = Adenosintriphosphat protoniert.svg
| {{Инфоелемент картинка|ATP-xtal-3D-balls.png}}
| ImageSize = 200px
}}
| ImageAlt =
| систематично = [(2''R'',3''S'',4''R'',5''R'')<br />-5-(6-аминопурин-9-ил)-3,4-<br />дихидроксиоксолан-2-ил]метил<br />(хидроксифосфонооксифосфорил)<br />хидроген фосфат
| ImageCaption =
| други други_имена = аденозин 5'-(тетрахидроген трифосфат)
| ImageFile1 = AdenosineTriphosphate.qutemol.gif
| ImageSize1 = 150px
| ImageAlt1 =
| ImageCaption1 =
| ImageFile2 = ATP-xtal-3D-balls.png
| ImageSize2 = 150px
| ImageAlt2 =
| ImageCaption2 =
}}
| {{Химкаре имена-орг
| систематично = [(2''R'',3''S'',4''R'',5''R'')<br />-5-(6-аминопурин-9-ил)-3,4-<br />дихидроксиоксолан-2-ил]метил<br />(хидроксифосфонооксифосфорил)<br />хидроген фосфат
| други = аденозин 5'-(тетрахидроген трифосфат)
}}
| {{Химкаре идентификатори-орг
| CASNo = 56-65-5
| DrugBank = DB00171
| ChemSpider ChemSpiderID = 5742
| EINECS =
| UNNumber =
| PubChem = 5957
| RTECS =
| KEGG = C00002
| MeSHName =
| ATCCode =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =
| ChEBI = 15422
| SMILES = O=P(O)(O)OP(=O)(O)OP(=O)(O)OC<br />[C@H]3O[C@@H](n2cnc1c(ncnc12)N)<br />[C@H](O)[C@@H]3O
| Beilstein =
| Gmelin =
| 3DMet =
| SMILES = O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3O
| SMILES1 = c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO[P@@](=O)(O)O[P@@](=O)(O)OP(=O)(O)O)O)O)N
| InChI = 1S/C10H16N5O13P3/c11-8-5-9<br />(13-2-12-8)15(3-14-5)10-7(17)6<br />(16)4(26-10)1-25-30(21,22)28-31<br />(23,24)27-29(18,19)20/h2-4,6-7,10,<br />16-17H,1H2,(H,21,22)(H,23,24)<br />(H2,11,12,13)(H2,18,19,20)<br />/t4-,6-,7-,10-/m1/s1
| формула = C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>13</sub>P<sub>3</sub>
}}
| моларна-маса = 507.18 g/mol
| {{Химкаре качества-орг
| плътност = 1.04 g/cm<sup>3</sup>
| формула = C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>13</sub>P<sub>3</sub>
| топене-точка = 187 °C
| моларна-маса = 507.18 g/mol
| моларна-бележки pKa = 6.5
| външен-вид =
| плътност = 1.04 g/cm<sup>3</sup>
| топене-точка = 187 °C
| топене-бележки =
| кипене-точка =
| кипене-бележки =
| сублимация =
| разтворимост =
| разтворимост-в =
| разтворимост-продукт =
| pKa = 6.5
| pKa-група =
| pKb =
| pKb-група =
| ламбда-макс =
| ламбда-макс-абсорбиране =
| забранена-зона =
| подвижност-токоносители =
| специфично-въртене =
| магнитна-чувствителност =
| топлопроводимост =
| показател-на-пречупване =
| критична-относителна-влажност =
| дипол =
}}
}}
 
'''Аденозинтрифосфорната киселина''' (''аденозинтрифосфат'' или ''АТФ'') представлява химично [[макроергично съединение]], което съдържа богати на енергия връзки. Изграден е от 3 основни съставки: азотна база [[аденин]], [[рибоза]] и 3 остатъка от [[фосфорна киселина]].
 
АТФ съдържа в молекулата си 2 макроергични връзки, които при разкъсването си освобождават енергия за нуждите на организма.
 
== Получаване ==
АТФ може да се получи при разграждането на [[мазнини]], [[белтъци]] (по-малко) и [[въглехидрати]] в основния метаболизъм на клетката. Основното количество АТФ се получава при окислителното фосфорилиране в [[митохондрии]]те.